C24H21Cl2NO5 — CID 118565475
[(1S)-2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate (PubChem CID 118565475) has the molecular formula C24H21Cl2NO5 and a molecular weight of 474.34 g/mol. Its IUPAC name is [(1S)-2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate.
| Compound Name | [(1S)-2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate |
|---|---|
| PubChem CID | 118565475 |
| Molecular Formula | C24H21Cl2NO5 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | [(1S)-2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate |
| SMILES | COc1ccc([C@H](Cc2c(Cl)cncc2Cl)OC(=O)Cc2ccc(C=O)cc2)cc1OC |
| InChI | InChI=1S/C24H21Cl2NO5/c1-30-21-8-7-17(10-23(21)31-2)22(11-18-19(25)12-27-13-20(18)26)32-24(29)9-15-3-5-16(14-28)6-4-15/h3-8,10,12-14,22H,9,11H2,1-2H3/t22-/m0/s1 |
| InChIKey | BUWLGPKZGTUZGI-QFIPXVFZSA-N |
| XLogP | 5.29 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|