C24H23Cl2NO6 — CID 157469619
[(1S)-2-(3,5-dichloropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate hydroxide (PubChem CID 157469619) has the molecular formula C24H23Cl2NO6 and a molecular weight of 492.36 g/mol. Its IUPAC name is [(1S)-2-(3,5-dichloropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate hydroxide.
| Compound Name | [(1S)-2-(3,5-dichloropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate hydroxide |
|---|---|
| PubChem CID | 157469619 |
| Molecular Formula | C24H23Cl2NO6 |
| Molecular Weight | 492.36 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | [(1S)-2-(3,5-dichloropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate hydroxide |
| SMILES | COc1ccc([C@H](Cc2c(Cl)c[nH+]cc2Cl)OC(=O)Cc2ccc(C=O)cc2)cc1OC.[OH-] |
| InChI | InChI=1S/C24H21Cl2NO5.H2O/c1-30-21-8-7-17(10-23(21)31-2)22(11-18-19(25)12-27-13-20(18)26)32-24(29)9-15-3-5-16(14-28)6-4-15;/h3-8,10,12-14,22H,9,11H2,1-2H3;1H2/t22-;/m0./s1 |
| InChIKey | PFIPVVUQQBFCCY-FTBISJDPSA-N |
| XLogP | 4.53 |
| TPSA | 105.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|