C21H17Cl2NO5S — CID 118135484
[(1S)-2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxyphenyl)ethyl] 4-formylthiophene-2-carboxylate (PubChem CID 118135484) has the molecular formula C21H17Cl2NO5S and a molecular weight of 466.34 g/mol. Its IUPAC name is [(1S)-2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxyphenyl)ethyl] 4-formylthiophene-2-carboxylate.
| Compound Name | [(1S)-2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxyphenyl)ethyl] 4-formylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 118135484 |
| Molecular Formula | C21H17Cl2NO5S |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | [(1S)-2-(3,5-dichloro-4-pyridinyl)-1-(3,4-dimethoxyphenyl)ethyl] 4-formylthiophene-2-carboxylate |
| SMILES | COc1ccc([C@H](Cc2c(Cl)cncc2Cl)OC(=O)c2cc(C=O)cs2)cc1OC |
| InChI | InChI=1S/C21H17Cl2NO5S/c1-27-17-4-3-13(6-19(17)28-2)18(7-14-15(22)8-24-9-16(14)23)29-21(26)20-5-12(10-25)11-30-20/h3-6,8-11,18H,7H2,1-2H3/t18-/m0/s1 |
| InChIKey | CWVRGCPQOMVNCY-SFHVURJKSA-N |
| XLogP | 5.42 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|