C29H25Cl2NO6 — CID 162336462
[(1S)-2-(3,5-dichloropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 4-(3-formylphenyl)benzoate hydroxide (PubChem CID 162336462) has the molecular formula C29H25Cl2NO6 and a molecular weight of 554.43 g/mol. Its IUPAC name is [(1S)-2-(3,5-dichloropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 4-(3-formylphenyl)benzoate hydroxide.
| Compound Name | [(1S)-2-(3,5-dichloropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 4-(3-formylphenyl)benzoate hydroxide |
|---|---|
| PubChem CID | 162336462 |
| Molecular Formula | C29H25Cl2NO6 |
| Molecular Weight | 554.43 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | [(1S)-2-(3,5-dichloropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 4-(3-formylphenyl)benzoate hydroxide |
| SMILES | COc1ccc([C@H](Cc2c(Cl)c[nH+]cc2Cl)OC(=O)c2ccc(-c3cccc(C=O)c3)cc2)cc1OC.[OH-] |
| InChI | InChI=1S/C29H23Cl2NO5.H2O/c1-35-26-11-10-22(13-28(26)36-2)27(14-23-24(30)15-32-16-25(23)31)37-29(34)20-8-6-19(7-9-20)21-5-3-4-18(12-21)17-33;/h3-13,15-17,27H,14H2,1-2H3;1H2/t27-;/m0./s1 |
| InChIKey | UVELVTOUAUFKAI-YCBFMBTMSA-N |
| XLogP | 6.27 |
| TPSA | 105.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.43 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|