C27H26Cl2NO5+ — CID 140642777
[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(3,5-dichloropyridin-1-ium-4-yl)ethyl] 4-formylbenzoate (PubChem CID 140642777) has the molecular formula C27H26Cl2NO5+ and a molecular weight of 515.41 g/mol. Its IUPAC name is [1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(3,5-dichloropyridin-1-ium-4-yl)ethyl] 4-formylbenzoate.
| Compound Name | [1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(3,5-dichloropyridin-1-ium-4-yl)ethyl] 4-formylbenzoate |
|---|---|
| PubChem CID | 140642777 |
| Molecular Formula | C27H26Cl2NO5+ |
| Molecular Weight | 515.41 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | [1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(3,5-dichloropyridin-1-ium-4-yl)ethyl] 4-formylbenzoate |
| SMILES | COc1ccc(C(Cc2c(Cl)c[nH+]cc2Cl)OC(=O)c2ccc(C=O)cc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C27H25Cl2NO5/c1-33-24-11-10-19(12-26(24)34-20-4-2-3-5-20)25(13-21-22(28)14-30-15-23(21)29)35-27(32)18-8-6-17(16-31)7-9-18/h6-12,14-16,20,25H,2-5,13H2,1H3/p+1 |
| InChIKey | VZVKERBZTMARDG-UHFFFAOYSA-O |
| XLogP | 6.09 |
| TPSA | 75.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.41 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|