C26H26Cl2N2O5 — CID 118519496
[1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-aminobenzoate (PubChem CID 118519496) has the molecular formula C26H26Cl2N2O5 and a molecular weight of 517.41 g/mol. Its IUPAC name is [1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-aminobenzoate.
| Compound Name | [1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 118519496 |
| Molecular Formula | C26H26Cl2N2O5 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | [1-(3-cyclopentyloxy-4-methoxyphenyl)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-aminobenzoate |
| SMILES | COc1ccc(C(Cc2c(Cl)c[n+]([O-])cc2Cl)OC(=O)c2ccc(N)cc2)cc1OC1CCCC1 |
| InChI | InChI=1S/C26H26Cl2N2O5/c1-33-23-11-8-17(12-25(23)34-19-4-2-3-5-19)24(13-20-21(27)14-30(32)15-22(20)28)35-26(31)16-6-9-18(29)10-7-16/h6-12,14-15,19,24H,2-5,13,29H2,1H3 |
| InChIKey | BQTRKEDVPKOPIN-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|