C27H27Cl2F2N3O5 — CID 71542820
[(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] N-[(4-aminophenyl)methyl]-N-methylcarbamate (PubChem CID 71542820) has the molecular formula C27H27Cl2F2N3O5 and a molecular weight of 582.43 g/mol. Its IUPAC name is [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] N-[(4-aminophenyl)methyl]-N-methylcarbamate.
| Compound Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] N-[(4-aminophenyl)methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 71542820 |
| Molecular Formula | C27H27Cl2F2N3O5 |
| Molecular Weight | 582.43 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] N-[(4-aminophenyl)methyl]-N-methylcarbamate |
| SMILES | CN(Cc1ccc(N)cc1)C(=O)O[C@@H](Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C27H27Cl2F2N3O5/c1-33(12-16-4-7-19(32)8-5-16)27(35)39-24(11-20-21(28)13-34(36)14-22(20)29)18-6-9-23(38-26(30)31)25(10-18)37-15-17-2-3-17/h4-10,13-14,17,24,26H,2-3,11-12,15,32H2,1H3/t24-/m0/s1 |
| InChIKey | XQRIHYTVJOARDW-DEOSSOPVSA-N |
| XLogP | 6.15 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.43 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|