C25H21Cl2F2NO6 — CID 89455916
[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] phenyl carbonate (PubChem CID 89455916) has the molecular formula C25H21Cl2F2NO6 and a molecular weight of 540.35 g/mol. Its IUPAC name is [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] phenyl carbonate.
| Compound Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] phenyl carbonate |
|---|---|
| PubChem CID | 89455916 |
| Molecular Formula | C25H21Cl2F2NO6 |
| Molecular Weight | 540.35 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] phenyl carbonate |
| SMILES | O=C(Oc1ccccc1)OC(Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C25H21Cl2F2NO6/c26-19-12-30(32)13-20(27)18(19)11-22(36-25(31)34-17-4-2-1-3-5-17)16-8-9-21(35-24(28)29)23(10-16)33-14-15-6-7-15/h1-5,8-10,12-13,15,22,24H,6-7,11,14H2 |
| InChIKey | OMOAFAIBHQJBBO-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.35 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|