C33H28Cl2F3NO5 — CID 118519506
[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-(3-fluoro-4-phenylphenyl)propanoate (PubChem CID 118519506) has the molecular formula C33H28Cl2F3NO5 and a molecular weight of 646.49 g/mol. Its IUPAC name is [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-(3-fluoro-4-phenylphenyl)propanoate.
| Compound Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-(3-fluoro-4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 118519506 |
| Molecular Formula | C33H28Cl2F3NO5 |
| Molecular Weight | 646.49 g/mol |
| Exact Mass | 645.13 |
| IUPAC Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-(3-fluoro-4-phenylphenyl)propanoate |
| SMILES | CC(C(=O)OC(Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C33H28Cl2F3NO5/c1-19(22-9-11-24(28(36)13-22)21-5-3-2-4-6-21)32(40)43-30(15-25-26(34)16-39(41)17-27(25)35)23-10-12-29(44-33(37)38)31(14-23)42-18-20-7-8-20/h2-6,9-14,16-17,19-20,30,33H,7-8,15,18H2,1H3 |
| InChIKey | LPRXKCQOZIUBQW-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.49 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|