C26H23Cl2F2NO6S — CID 78104960
[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] (4-methoxyphenyl)sulfanylformate (PubChem CID 78104960) has the molecular formula C26H23Cl2F2NO6S and a molecular weight of 586.44 g/mol. Its IUPAC name is [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] (4-methoxyphenyl)sulfanylformate.
| Compound Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] (4-methoxyphenyl)sulfanylformate |
|---|---|
| PubChem CID | 78104960 |
| Molecular Formula | C26H23Cl2F2NO6S |
| Molecular Weight | 586.44 g/mol |
| Exact Mass | 585.06 |
| IUPAC Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] (4-methoxyphenyl)sulfanylformate |
| SMILES | COc1ccc(SC(=O)OC(Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)cc1 |
| InChI | InChI=1S/C26H23Cl2F2NO6S/c1-34-17-5-7-18(8-6-17)38-26(32)37-23(11-19-20(27)12-31(33)13-21(19)28)16-4-9-22(36-25(29)30)24(10-16)35-14-15-2-3-15/h4-10,12-13,15,23,25H,2-3,11,14H2,1H3 |
| InChIKey | YPASISXZDHFSDI-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 80.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.44 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|