C28H27Cl2F2N2O7S2- — CID 86679570
3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(4-methylsulfanylphenyl)methyl-sulfinatoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium (PubChem CID 86679570) has the molecular formula C28H27Cl2F2N2O7S2- and a molecular weight of 676.57 g/mol. Its IUPAC name is 3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(4-methylsulfanylphenyl)methyl-sulfinatoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium.
| Compound Name | 3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(4-methylsulfanylphenyl)methyl-sulfinatoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 86679570 |
| Molecular Formula | C28H27Cl2F2N2O7S2- |
| Molecular Weight | 676.57 g/mol |
| Exact Mass | 675.06 |
| IUPAC Name | 3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(4-methylsulfanylphenyl)methyl-sulfinatoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium |
| SMILES | CSc1ccc(CN(CC(=O)O[C@@H](Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)S(=O)[O-])cc1 |
| InChI | InChI=1S/C28H28Cl2F2N2O7S2/c1-42-20-7-4-17(5-8-20)12-34(43(37)38)15-27(35)40-25(11-21-22(29)13-33(36)14-23(21)30)19-6-9-24(41-28(31)32)26(10-19)39-16-18-2-3-18/h4-10,13-14,18,25,28H,2-3,11-12,15-16H2,1H3,(H,37,38)/p-1/t25-/m0/s1 |
| InChIKey | KUPZENCSRVPODZ-VWLOTQADSA-M |
| XLogP | 5.86 |
| TPSA | 115.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|