C26H24Cl2F2N2O5S — CID 90187307
[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 3-amino-4-methylsulfanylbenzoate (PubChem CID 90187307) has the molecular formula C26H24Cl2F2N2O5S and a molecular weight of 585.46 g/mol. Its IUPAC name is [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 3-amino-4-methylsulfanylbenzoate.
| Compound Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 3-amino-4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 90187307 |
| Molecular Formula | C26H24Cl2F2N2O5S |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 584.08 |
| IUPAC Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 3-amino-4-methylsulfanylbenzoate |
| SMILES | CSc1ccc(C(=O)OC(Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)cc1N |
| InChI | InChI=1S/C26H24Cl2F2N2O5S/c1-38-24-7-5-16(8-20(24)31)25(33)36-22(10-17-18(27)11-32(34)12-19(17)28)15-4-6-21(37-26(29)30)23(9-15)35-13-14-2-3-14/h4-9,11-12,14,22,26H,2-3,10,13,31H2,1H3 |
| InChIKey | FYUPKTBGFGXVEV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|