C30H27Cl2F2NO7 — CID 90186988
[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-(cyclopropylmethoxy)-3-formylbenzoate (PubChem CID 90186988) has the molecular formula C30H27Cl2F2NO7 and a molecular weight of 622.45 g/mol. Its IUPAC name is [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-(cyclopropylmethoxy)-3-formylbenzoate.
| Compound Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-(cyclopropylmethoxy)-3-formylbenzoate |
|---|---|
| PubChem CID | 90186988 |
| Molecular Formula | C30H27Cl2F2NO7 |
| Molecular Weight | 622.45 g/mol |
| Exact Mass | 621.11 |
| IUPAC Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 4-(cyclopropylmethoxy)-3-formylbenzoate |
| SMILES | O=Cc1cc(C(=O)OC(Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)ccc1OCC1CC1 |
| InChI | InChI=1S/C30H27Cl2F2NO7/c31-23-12-35(38)13-24(32)22(23)11-27(19-5-8-26(42-30(33)34)28(10-19)40-16-18-3-4-18)41-29(37)20-6-7-25(21(9-20)14-36)39-15-17-1-2-17/h5-10,12-14,17-18,27,30H,1-4,11,15-16H2 |
| InChIKey | BGMMPTPNASYCCJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 98.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.45 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|