C23H21Cl2F2N3O5 — CID 118519529
[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 1-methylimidazole-4-carboxylate (PubChem CID 118519529) has the molecular formula C23H21Cl2F2N3O5 and a molecular weight of 528.34 g/mol. Its IUPAC name is [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 1-methylimidazole-4-carboxylate.
| Compound Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 1-methylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 118519529 |
| Molecular Formula | C23H21Cl2F2N3O5 |
| Molecular Weight | 528.34 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 1-methylimidazole-4-carboxylate |
| SMILES | Cn1cnc(C(=O)OC(Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)c1 |
| InChI | InChI=1S/C23H21Cl2F2N3O5/c1-29-10-18(28-12-29)22(31)34-20(7-15-16(24)8-30(32)9-17(15)25)14-4-5-19(35-23(26)27)21(6-14)33-11-13-2-3-13/h4-6,8-10,12-13,20,23H,2-3,7,11H2,1H3 |
| InChIKey | IGJQXOOWVWFKSF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|