C20H19Cl2F2NO6 — CID 86679512
[(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-hydroxyacetate (PubChem CID 86679512) has the molecular formula C20H19Cl2F2NO6 and a molecular weight of 478.28 g/mol. Its IUPAC name is [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-hydroxyacetate.
| Compound Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 86679512 |
| Molecular Formula | C20H19Cl2F2NO6 |
| Molecular Weight | 478.28 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-hydroxyacetate |
| SMILES | O=C(CO)O[C@@H](Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C20H19Cl2F2NO6/c21-14-7-25(28)8-15(22)13(14)6-17(30-19(27)9-26)12-3-4-16(31-20(23)24)18(5-12)29-10-11-1-2-11/h3-5,7-8,11,17,20,26H,1-2,6,9-10H2/t17-/m0/s1 |
| InChIKey | LEKIKWMWWKQSRA-KRWDZBQOSA-N |
| XLogP | 3.84 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|