C28H28Cl2F2N2O9S — CID 78104773
[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-[(3,4-dimethoxyphenyl)sulfamoyl]acetate (PubChem CID 78104773) has the molecular formula C28H28Cl2F2N2O9S and a molecular weight of 677.51 g/mol. Its IUPAC name is [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-[(3,4-dimethoxyphenyl)sulfamoyl]acetate.
| Compound Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-[(3,4-dimethoxyphenyl)sulfamoyl]acetate |
|---|---|
| PubChem CID | 78104773 |
| Molecular Formula | C28H28Cl2F2N2O9S |
| Molecular Weight | 677.51 g/mol |
| Exact Mass | 676.09 |
| IUPAC Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 2-[(3,4-dimethoxyphenyl)sulfamoyl]acetate |
| SMILES | COc1ccc(NS(=O)(=O)CC(=O)OC(Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)cc1OC |
| InChI | InChI=1S/C28H28Cl2F2N2O9S/c1-39-22-8-6-18(10-25(22)40-2)33-44(37,38)15-27(35)42-24(11-19-20(29)12-34(36)13-21(19)30)17-5-7-23(43-28(31)32)26(9-17)41-14-16-3-4-16/h5-10,12-13,16,24,28,33H,3-4,11,14-15H2,1-2H3 |
| InChIKey | MPHIDBVLLCJRGV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 136.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|