C26H23Cl2F2NO7 — CID 90187261
[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 3-hydroxy-4-methoxybenzoate (PubChem CID 90187261) has the molecular formula C26H23Cl2F2NO7 and a molecular weight of 570.37 g/mol. Its IUPAC name is [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 3-hydroxy-4-methoxybenzoate.
| Compound Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 3-hydroxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 90187261 |
| Molecular Formula | C26H23Cl2F2NO7 |
| Molecular Weight | 570.37 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 3-hydroxy-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC(Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)cc1O |
| InChI | InChI=1S/C26H23Cl2F2NO7/c1-35-21-6-5-16(8-20(21)32)25(33)37-23(10-17-18(27)11-31(34)12-19(17)28)15-4-7-22(38-26(29)30)24(9-15)36-13-14-2-3-14/h4-9,11-12,14,23,26,32H,2-3,10,13H2,1H3 |
| InChIKey | PZCMRYAWWGWNEQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.37 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|