C36H38Cl2F2N2O10 — CID 90186787
1-O-tert-butyl 2-O-[5-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]carbonyl-2-methoxyphenyl] pyrrolidine-1,2-dicarboxylate (PubChem CID 90186787) has the molecular formula C36H38Cl2F2N2O10 and a molecular weight of 767.61 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[5-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]carbonyl-2-methoxyphenyl] pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[5-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]carbonyl-2-methoxyphenyl] pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 90186787 |
| Molecular Formula | C36H38Cl2F2N2O10 |
| Molecular Weight | 767.61 g/mol |
| Exact Mass | 766.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-[5-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]carbonyl-2-methoxyphenyl] pyrrolidine-1,2-dicarboxylate |
| SMILES | COc1ccc(C(=O)OC(Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)cc1OC(=O)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H38Cl2F2N2O10/c1-36(2,3)52-35(45)42-13-5-6-26(42)33(44)50-31-15-22(10-11-27(31)47-4)32(43)49-29(16-23-24(37)17-41(46)18-25(23)38)21-9-12-28(51-34(39)40)30(14-21)48-19-20-7-8-20/h9-12,14-15,17-18,20,26,29,34H,5-8,13,16,19H2,1-4H3 |
| InChIKey | BVUFUOPSKSMAHP-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 136.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.61 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|