C29H30Cl2N2O7S — CID 71092511
[(1S)-1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 1-(benzenesulfonyl)pyrrolidine-2-carboxylate (PubChem CID 71092511) has the molecular formula C29H30Cl2N2O7S and a molecular weight of 621.54 g/mol. Its IUPAC name is [(1S)-1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 1-(benzenesulfonyl)pyrrolidine-2-carboxylate.
| Compound Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 1-(benzenesulfonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 71092511 |
| Molecular Formula | C29H30Cl2N2O7S |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-methoxyphenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethyl] 1-(benzenesulfonyl)pyrrolidine-2-carboxylate |
| SMILES | COc1ccc([C@H](Cc2c(Cl)c[n+]([O-])cc2Cl)OC(=O)C2CCCN2S(=O)(=O)c2ccccc2)cc1OCC1CC1 |
| InChI | InChI=1S/C29H30Cl2N2O7S/c1-38-26-12-11-20(14-28(26)39-18-19-9-10-19)27(15-22-23(30)16-32(35)17-24(22)31)40-29(34)25-8-5-13-33(25)41(36,37)21-6-3-2-4-7-21/h2-4,6-7,11-12,14,16-17,19,25,27H,5,8-10,13,15,18H2,1H3/t25?,27-/m0/s1 |
| InChIKey | ATFNKUOTYRXWKU-GPNIZQGCSA-N |
| XLogP | 5.10 |
| TPSA | 109.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|