C31H31Cl3F2N2O8 — CID 175012144
[5-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]carbonyl-2-methoxyphenyl] (2S)-pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 175012144) has the molecular formula C31H31Cl3F2N2O8 and a molecular weight of 703.95 g/mol. Its IUPAC name is [5-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]carbonyl-2-methoxyphenyl] (2S)-pyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | [5-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]carbonyl-2-methoxyphenyl] (2S)-pyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 175012144 |
| Molecular Formula | C31H31Cl3F2N2O8 |
| Molecular Weight | 703.95 g/mol |
| Exact Mass | 702.11 |
| IUPAC Name | [5-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]carbonyl-2-methoxyphenyl] (2S)-pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | COc1ccc(C(=O)OC(Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)cc1OC(=O)[C@@H]1CCCN1.Cl |
| InChI | InChI=1S/C31H30Cl2F2N2O8.ClH/c1-41-24-8-7-19(12-28(24)44-30(39)23-3-2-10-36-23)29(38)43-26(13-20-21(32)14-37(40)15-22(20)33)18-6-9-25(45-31(34)35)27(11-18)42-16-17-4-5-17;/h6-9,11-12,14-15,17,23,26,31,36H,2-5,10,13,16H2,1H3;1H/t23-,26?;/m0./s1 |
| InChIKey | NATXSGFODPFYPS-IFTYMYFCSA-N |
| XLogP | 6.25 |
| TPSA | 119.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.95 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|