C20H23Cl3N2O5 — CID 158548061
[(1S)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] (2S)-pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 158548061) has the molecular formula C20H23Cl3N2O5 and a molecular weight of 477.77 g/mol. Its IUPAC name is [(1S)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] (2S)-pyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | [(1S)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] (2S)-pyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 158548061 |
| Molecular Formula | C20H23Cl3N2O5 |
| Molecular Weight | 477.77 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | [(1S)-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] (2S)-pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | COc1ccc([C@H](Cc2c(Cl)c[n+]([O-])cc2Cl)OC(=O)[C@@H]2CCCN2)cc1OC.Cl |
| InChI | InChI=1S/C20H22Cl2N2O5.ClH/c1-27-17-6-5-12(8-19(17)28-2)18(29-20(25)16-4-3-7-23-16)9-13-14(21)10-24(26)11-15(13)22;/h5-6,8,10-11,16,18,23H,3-4,7,9H2,1-2H3;1H/t16-,18-;/m0./s1 |
| InChIKey | GQOIIUMAMHTKON-AKXYIILFSA-N |
| XLogP | 3.64 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|