C29H29Cl2F2N2O9S- — CID 89455553
3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(3,4-dimethoxyphenyl)methyl-sulfinatoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium (PubChem CID 89455553) has the molecular formula C29H29Cl2F2N2O9S- and a molecular weight of 690.53 g/mol. Its IUPAC name is 3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(3,4-dimethoxyphenyl)methyl-sulfinatoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium.
| Compound Name | 3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(3,4-dimethoxyphenyl)methyl-sulfinatoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 89455553 |
| Molecular Formula | C29H29Cl2F2N2O9S- |
| Molecular Weight | 690.53 g/mol |
| Exact Mass | 689.09 |
| IUPAC Name | 3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(3,4-dimethoxyphenyl)methyl-sulfinatoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium |
| SMILES | COc1ccc(CN(CC(=O)O[C@@H](Cc2c(Cl)c[n+]([O-])cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)S(=O)[O-])cc1OC |
| InChI | InChI=1S/C29H30Cl2F2N2O9S/c1-40-23-7-5-18(9-26(23)41-2)12-35(45(38)39)15-28(36)43-25(11-20-21(30)13-34(37)14-22(20)31)19-6-8-24(44-29(32)33)27(10-19)42-16-17-3-4-17/h5-10,13-14,17,25,29H,3-4,11-12,15-16H2,1-2H3,(H,38,39)/p-1/t25-/m0/s1 |
| InChIKey | FBOVGIJLNDMLOR-VWLOTQADSA-M |
| XLogP | 5.16 |
| TPSA | 133.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|