C29H28Cl2F2N2O9S — CID 89455853
3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(2-methoxycarbonylphenyl)methyl-sulfinoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium (PubChem CID 89455853) has the molecular formula C29H28Cl2F2N2O9S and a molecular weight of 689.52 g/mol. Its IUPAC name is 3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(2-methoxycarbonylphenyl)methyl-sulfinoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium.
| Compound Name | 3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(2-methoxycarbonylphenyl)methyl-sulfinoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 89455853 |
| Molecular Formula | C29H28Cl2F2N2O9S |
| Molecular Weight | 689.52 g/mol |
| Exact Mass | 688.09 |
| IUPAC Name | 3,5-dichloro-4-[(2S)-2-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-[2-[(2-methoxycarbonylphenyl)methyl-sulfinoamino]acetyl]oxyethyl]-1-oxidopyridin-1-ium |
| SMILES | COC(=O)c1ccccc1CN(CC(=O)O[C@@H](Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1)S(=O)O |
| InChI | InChI=1S/C29H28Cl2F2N2O9S/c1-41-28(37)20-5-3-2-4-19(20)12-35(45(39)40)15-27(36)43-25(11-21-22(30)13-34(38)14-23(21)31)18-8-9-24(44-29(32)33)26(10-18)42-16-17-6-7-17/h2-5,8-10,13-14,17,25,29H,6-7,11-12,15-16H2,1H3,(H,39,40)/t25-/m0/s1 |
| InChIKey | RVDKSLNCSHIWMT-VWLOTQADSA-N |
| XLogP | 5.27 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|