C34H30Cl2F2N2O8 — CID 134280257
2-[3-[2-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]-2-oxoethoxy]anilino]-2-phenylacetic acid (PubChem CID 134280257) has the molecular formula C34H30Cl2F2N2O8 and a molecular weight of 703.52 g/mol. Its IUPAC name is 2-[3-[2-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]-2-oxoethoxy]anilino]-2-phenylacetic acid.
| Compound Name | 2-[3-[2-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]-2-oxoethoxy]anilino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 134280257 |
| Molecular Formula | C34H30Cl2F2N2O8 |
| Molecular Weight | 703.52 g/mol |
| Exact Mass | 702.13 |
| IUPAC Name | 2-[3-[2-[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-oxidopyridin-1-ium-4-yl)ethoxy]-2-oxoethoxy]anilino]-2-phenylacetic acid |
| SMILES | O=C(COc1cccc(NC(C(=O)O)c2ccccc2)c1)OC(Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C34H30Cl2F2N2O8/c35-26-16-40(44)17-27(36)25(26)15-29(22-11-12-28(48-34(37)38)30(13-22)46-18-20-9-10-20)47-31(41)19-45-24-8-4-7-23(14-24)39-32(33(42)43)21-5-2-1-3-6-21/h1-8,11-14,16-17,20,29,32,34,39H,9-10,15,18-19H2,(H,42,43) |
| InChIKey | PSXDUYDNJBDONI-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 130.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.52 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|