C25H20Cl2F2N2O7 — CID 90150606
[1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] (4-nitrophenyl) carbonate (PubChem CID 90150606) has the molecular formula C25H20Cl2F2N2O7 and a molecular weight of 569.34 g/mol. Its IUPAC name is [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] (4-nitrophenyl) carbonate.
| Compound Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 90150606 |
| Molecular Formula | C25H20Cl2F2N2O7 |
| Molecular Weight | 569.34 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | [1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] (4-nitrophenyl) carbonate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)OC(Cc1c(Cl)cncc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C25H20Cl2F2N2O7/c26-19-11-30-12-20(27)18(19)10-22(38-25(32)36-17-6-4-16(5-7-17)31(33)34)15-3-8-21(37-24(28)29)23(9-15)35-13-14-1-2-14/h3-9,11-12,14,22,24H,1-2,10,13H2 |
| InChIKey | QRMAEISGBSYGIL-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 110.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.34 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|