C28H25Cl2F2N3O8S2 — CID 123917357
[(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] 3-(4-nitrophenyl)sulfonyl-1,3-thiazolidine-2-carboxylate (PubChem CID 123917357) has the molecular formula C28H25Cl2F2N3O8S2 and a molecular weight of 704.56 g/mol. Its IUPAC name is [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] 3-(4-nitrophenyl)sulfonyl-1,3-thiazolidine-2-carboxylate.
| Compound Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] 3-(4-nitrophenyl)sulfonyl-1,3-thiazolidine-2-carboxylate |
|---|---|
| PubChem CID | 123917357 |
| Molecular Formula | C28H25Cl2F2N3O8S2 |
| Molecular Weight | 704.56 g/mol |
| Exact Mass | 703.04 |
| IUPAC Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-4-pyridinyl)ethyl] 3-(4-nitrophenyl)sulfonyl-1,3-thiazolidine-2-carboxylate |
| SMILES | O=C(O[C@@H](Cc1c(Cl)cncc1Cl)c1ccc(OC(F)F)c(OCC2CC2)c1)C1SCCN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H25Cl2F2N3O8S2/c29-21-13-33-14-22(30)20(21)12-24(17-3-8-23(43-28(31)32)25(11-17)41-15-16-1-2-16)42-27(36)26-34(9-10-44-26)45(39,40)19-6-4-18(5-7-19)35(37)38/h3-8,11,13-14,16,24,26,28H,1-2,9-10,12,15H2/t24-,26?/m0/s1 |
| InChIKey | NGCLPDLAEFDWDQ-QSAPEBAKSA-N |
| XLogP | 6.28 |
| TPSA | 138.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.56 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|