C26H26Cl2F2N3O5+ — CID 89484899
[(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)ethyl] N-[(4-aminophenyl)methyl]carbamate (PubChem CID 89484899) has the molecular formula C26H26Cl2F2N3O5+ and a molecular weight of 569.41 g/mol. Its IUPAC name is [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)ethyl] N-[(4-aminophenyl)methyl]carbamate.
| Compound Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)ethyl] N-[(4-aminophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 89484899 |
| Molecular Formula | C26H26Cl2F2N3O5+ |
| Molecular Weight | 569.41 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)ethyl] N-[(4-aminophenyl)methyl]carbamate |
| SMILES | Nc1ccc(CNC(=O)O[C@@H](Cc2c(Cl)c[n+](O)cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)cc1 |
| InChI | InChI=1S/C26H25Cl2F2N3O5/c27-20-12-33(35)13-21(28)19(20)10-23(38-26(34)32-11-15-3-6-18(31)7-4-15)17-5-8-22(37-25(29)30)24(9-17)36-14-16-1-2-16/h3-9,12-13,16,23,25H,1-2,10-11,14,31H2,(H-,32,34,35)/p+1/t23-/m0/s1 |
| InChIKey | GEVQVIOJQLIJSX-QHCPKHFHSA-O |
| XLogP | 5.70 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|