C29H29Cl2F2N2O10S+ — CID 90160974
[(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)ethyl] 2-[(4-methoxy-3-methylsulfonyloxybenzoyl)amino]acetate (PubChem CID 90160974) has the molecular formula C29H29Cl2F2N2O10S+ and a molecular weight of 706.52 g/mol. Its IUPAC name is [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)ethyl] 2-[(4-methoxy-3-methylsulfonyloxybenzoyl)amino]acetate.
| Compound Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)ethyl] 2-[(4-methoxy-3-methylsulfonyloxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 90160974 |
| Molecular Formula | C29H29Cl2F2N2O10S+ |
| Molecular Weight | 706.52 g/mol |
| Exact Mass | 705.09 |
| IUPAC Name | [(1S)-1-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]-2-(3,5-dichloro-1-hydroxypyridin-1-ium-4-yl)ethyl] 2-[(4-methoxy-3-methylsulfonyloxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)O[C@@H](Cc2c(Cl)c[n+](O)cc2Cl)c2ccc(OC(F)F)c(OCC3CC3)c2)cc1OS(C)(=O)=O |
| InChI | InChI=1S/C29H28Cl2F2N2O10S/c1-41-22-7-6-18(10-26(22)45-46(2,39)40)28(37)34-12-27(36)43-24(11-19-20(30)13-35(38)14-21(19)31)17-5-8-23(44-29(32)33)25(9-17)42-15-16-3-4-16/h5-10,13-14,16,24,29H,3-4,11-12,15H2,1-2H3,(H-,34,37,38)/p+1/t24-/m0/s1 |
| InChIKey | JGHXAYMUUKOILU-DEOSSOPVSA-O |
| XLogP | 4.51 |
| TPSA | 150.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|