C22H19Cl2NO5S — CID 118135482
[2-(3,5-dichloro-4-pyridinyl)-1-(3-ethoxy-4-methoxyphenyl)ethyl] 5-formylthiophene-2-carboxylate (PubChem CID 118135482) has the molecular formula C22H19Cl2NO5S and a molecular weight of 480.37 g/mol. Its IUPAC name is [2-(3,5-dichloro-4-pyridinyl)-1-(3-ethoxy-4-methoxyphenyl)ethyl] 5-formylthiophene-2-carboxylate.
| Compound Name | [2-(3,5-dichloro-4-pyridinyl)-1-(3-ethoxy-4-methoxyphenyl)ethyl] 5-formylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 118135482 |
| Molecular Formula | C22H19Cl2NO5S |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | [2-(3,5-dichloro-4-pyridinyl)-1-(3-ethoxy-4-methoxyphenyl)ethyl] 5-formylthiophene-2-carboxylate |
| SMILES | CCOc1cc(C(Cc2c(Cl)cncc2Cl)OC(=O)c2ccc(C=O)s2)ccc1OC |
| InChI | InChI=1S/C22H19Cl2NO5S/c1-3-29-20-8-13(4-6-18(20)28-2)19(9-15-16(23)10-25-11-17(15)24)30-22(27)21-7-5-14(12-26)31-21/h4-8,10-12,19H,3,9H2,1-2H3 |
| InChIKey | PXDVKQQIWRMMKD-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|