C24H24Cl2NO5+ — CID 144971175
[(1S)-2-(3,5-dichloro-1,2-dihydropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate (PubChem CID 144971175) has the molecular formula C24H24Cl2NO5+ and a molecular weight of 477.36 g/mol. Its IUPAC name is [(1S)-2-(3,5-dichloro-1,2-dihydropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate.
| Compound Name | [(1S)-2-(3,5-dichloro-1,2-dihydropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate |
|---|---|
| PubChem CID | 144971175 |
| Molecular Formula | C24H24Cl2NO5+ |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | [(1S)-2-(3,5-dichloro-1,2-dihydropyridin-1-ium-4-yl)-1-(3,4-dimethoxyphenyl)ethyl] 2-(4-formylphenyl)acetate |
| SMILES | COc1ccc([C@H](CC2=C(Cl)C[NH2+]C=C2Cl)OC(=O)Cc2ccc(C=O)cc2)cc1OC |
| InChI | InChI=1S/C24H23Cl2NO5/c1-30-21-8-7-17(10-23(21)31-2)22(11-18-19(25)12-27-13-20(18)26)32-24(29)9-15-3-5-16(14-28)6-4-15/h3-8,10,12,14,22,27H,9,11,13H2,1-2H3/p+1/t22-/m0/s1 |
| InChIKey | HIBDGNWIRZZMHW-QFIPXVFZSA-O |
| XLogP | 3.88 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|