C11H10O — CID 13467286
(1R,8S,9S,11R)-10-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene (PubChem CID 13467286) has the molecular formula C11H10O and a molecular weight of 158.20 g/mol. Its IUPAC name is (1R,8S,9S,11R)-10-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene.
| Compound Name | (1R,8S,9S,11R)-10-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 13467286 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | (1R,8S,9S,11R)-10-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
| SMILES | c1ccc2c(c1)[C@H]1C[C@@H]2[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C11H10O/c1-2-4-7-6(3-1)8-5-9(7)11-10(8)12-11/h1-4,8-11H,5H2/t8-,9+,10-,11+ |
| InChIKey | KITHTTSINQXROM-DTIDVZRVSA-N |
| XLogP | 2.04 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|