C14H14 — CID 171447567
tricyclo[6.6.0.02,7]tetradeca-2,4,6-trien-11-yne (PubChem CID 171447567) has the molecular formula C14H14 and a molecular weight of 182.27 g/mol. Its IUPAC name is tricyclo[6.6.0.02,7]tetradeca-2,4,6-trien-11-yne.
| Compound Name | tricyclo[6.6.0.02,7]tetradeca-2,4,6-trien-11-yne |
|---|---|
| PubChem CID | 171447567 |
| Molecular Formula | C14H14 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | tricyclo[6.6.0.02,7]tetradeca-2,4,6-trien-11-yne |
| SMILES | C1#CCCC2c3ccccc3C2CC1 |
| InChI | InChI=1S/C14H14/c1-2-4-8-12-11(7-3-1)13-9-5-6-10-14(12)13/h5-6,9-12H,3-4,7-8H2 |
| InChIKey | YGCIIGWHZNXWBF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|