C15H11F3O8S — CID 22392720
11-oxo-4-(trifluoromethylsulfonyloxy)tricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylic acid (PubChem CID 22392720) has the molecular formula C15H11F3O8S and a molecular weight of 408.31 g/mol. Its IUPAC name is 11-oxo-4-(trifluoromethylsulfonyloxy)tricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylic acid.
| Compound Name | 11-oxo-4-(trifluoromethylsulfonyloxy)tricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylic acid |
|---|---|
| PubChem CID | 22392720 |
| Molecular Formula | C15H11F3O8S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 11-oxo-4-(trifluoromethylsulfonyloxy)tricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene-9,10-dicarboxylic acid |
| SMILES | O=C1CC2c3ccc(OS(=O)(=O)C(F)(F)F)cc3C1C(C(=O)O)C2C(=O)O |
| InChI | InChI=1S/C15H11F3O8S/c16-15(17,18)27(24,25)26-5-1-2-6-7(3-5)10-9(19)4-8(6)11(13(20)21)12(10)14(22)23/h1-3,8,10-12H,4H2,(H,20,21)(H,22,23) |
| InChIKey | JDWQIMUPBOLXDO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 135.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|