C15H12F6O6S — CID 89256211
2-[1-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetic acid (PubChem CID 89256211) has the molecular formula C15H12F6O6S and a molecular weight of 434.31 g/mol. Its IUPAC name is 2-[1-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetic acid.
| Compound Name | 2-[1-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetic acid |
|---|---|
| PubChem CID | 89256211 |
| Molecular Formula | C15H12F6O6S |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 2-[1-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetic acid |
| SMILES | O=C(O)CC1(CC(F)(F)F)CCc2cc(OS(=O)(=O)C(F)(F)F)ccc2C1=O |
| InChI | InChI=1S/C15H12F6O6S/c16-14(17,18)7-13(6-11(22)23)4-3-8-5-9(1-2-10(8)12(13)24)27-28(25,26)15(19,20)21/h1-2,5H,3-4,6-7H2,(H,22,23) |
| InChIKey | DTHOCUCYNXVUPN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|