C21H10F4O5S — CID 102517973
[4-(4-fluorophenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate (PubChem CID 102517973) has the molecular formula C21H10F4O5S and a molecular weight of 450.37 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate.
| Compound Name | [4-(4-fluorophenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 102517973 |
| Molecular Formula | C21H10F4O5S |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | [4-(4-fluorophenyl)-9,10-dioxoanthracen-2-yl] trifluoromethanesulfonate |
| SMILES | O=C1c2ccccc2C(=O)c2c1cc(OS(=O)(=O)C(F)(F)F)cc2-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H10F4O5S/c22-12-7-5-11(6-8-12)16-9-13(30-31(28,29)21(23,24)25)10-17-18(16)20(27)15-4-2-1-3-14(15)19(17)26/h1-10H |
| InChIKey | YZPHCCPOCVTGAW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|