C16H10F6O7S2 — CID 52912901
[4-oxo-10-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-anthracen-9-yl] trifluoromethanesulfonate (PubChem CID 52912901) has the molecular formula C16H10F6O7S2 and a molecular weight of 492.37 g/mol. Its IUPAC name is [4-oxo-10-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-anthracen-9-yl] trifluoromethanesulfonate.
| Compound Name | [4-oxo-10-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-anthracen-9-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 52912901 |
| Molecular Formula | C16H10F6O7S2 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | [4-oxo-10-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-anthracen-9-yl] trifluoromethanesulfonate |
| SMILES | O=C1CCCc2c1c(OS(=O)(=O)C(F)(F)F)c1ccccc1c2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H10F6O7S2/c17-15(18,19)30(24,25)28-13-8-4-1-2-5-9(8)14(29-31(26,27)16(20,21)22)12-10(13)6-3-7-11(12)23/h1-2,4-5H,3,6-7H2 |
| InChIKey | VRWMGWDJQHWMFS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|