C22H23F3O4S — CID 135076021
[1-[2-[(1S)-1-methyl-3-propan-2-ylcyclopent-2-en-1-yl]acetyl]naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 135076021) has the molecular formula C22H23F3O4S and a molecular weight of 440.48 g/mol. Its IUPAC name is [1-[2-[(1S)-1-methyl-3-propan-2-ylcyclopent-2-en-1-yl]acetyl]naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [1-[2-[(1S)-1-methyl-3-propan-2-ylcyclopent-2-en-1-yl]acetyl]naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135076021 |
| Molecular Formula | C22H23F3O4S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | [1-[2-[(1S)-1-methyl-3-propan-2-ylcyclopent-2-en-1-yl]acetyl]naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)C1=C[C@](C)(CC(=O)c2c(OS(=O)(=O)C(F)(F)F)ccc3ccccc23)CC1 |
| InChI | InChI=1S/C22H23F3O4S/c1-14(2)16-10-11-21(3,12-16)13-18(26)20-17-7-5-4-6-15(17)8-9-19(20)29-30(27,28)22(23,24)25/h4-9,12,14H,10-11,13H2,1-3H3/t21-/m1/s1 |
| InChIKey | MQBHDQIDWHFWIM-OAQYLSRUSA-N |
| XLogP | 6.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|