C20H10F6O7S2 — CID 135017607
[12-oxo-10-(trifluoromethylsulfonyloxy)-3-tetracyclo[11.4.1.02,11.04,9]octadeca-2,4,6,8,10,13(18),14,16-octaenyl] trifluoromethanesulfonate (PubChem CID 135017607) has the molecular formula C20H10F6O7S2 and a molecular weight of 540.42 g/mol. Its IUPAC name is [12-oxo-10-(trifluoromethylsulfonyloxy)-3-tetracyclo[11.4.1.02,11.04,9]octadeca-2,4,6,8,10,13(18),14,16-octaenyl] trifluoromethanesulfonate.
| Compound Name | [12-oxo-10-(trifluoromethylsulfonyloxy)-3-tetracyclo[11.4.1.02,11.04,9]octadeca-2,4,6,8,10,13(18),14,16-octaenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 135017607 |
| Molecular Formula | C20H10F6O7S2 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 539.98 |
| IUPAC Name | [12-oxo-10-(trifluoromethylsulfonyloxy)-3-tetracyclo[11.4.1.02,11.04,9]octadeca-2,4,6,8,10,13(18),14,16-octaenyl] trifluoromethanesulfonate |
| SMILES | O=C1C2=CC(C=CC=C2)c2c1c(OS(=O)(=O)C(F)(F)F)c1ccccc1c2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H10F6O7S2/c21-19(22,23)34(28,29)32-17-12-7-3-4-8-13(12)18(33-35(30,31)20(24,25)26)15-14(17)10-5-1-2-6-11(9-10)16(15)27/h1-10H |
| InChIKey | CKIFLMPWZUXXKE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|