C22H17F3O7S — CID 154707163
(1,8-dimethoxy-3-methyl-7,12-dioxo-5,6-dihydrobenzo[a]anthracen-11-yl) trifluoromethanesulfonate (PubChem CID 154707163) has the molecular formula C22H17F3O7S and a molecular weight of 482.43 g/mol. Its IUPAC name is (1,8-dimethoxy-3-methyl-7,12-dioxo-5,6-dihydrobenzo[a]anthracen-11-yl) trifluoromethanesulfonate.
| Compound Name | (1,8-dimethoxy-3-methyl-7,12-dioxo-5,6-dihydrobenzo[a]anthracen-11-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 154707163 |
| Molecular Formula | C22H17F3O7S |
| Molecular Weight | 482.43 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | (1,8-dimethoxy-3-methyl-7,12-dioxo-5,6-dihydrobenzo[a]anthracen-11-yl) trifluoromethanesulfonate |
| SMILES | COc1cc(C)cc2c1C1=C(CC2)C(=O)c2c(OC)ccc(OS(=O)(=O)C(F)(F)F)c2C1=O |
| InChI | InChI=1S/C22H17F3O7S/c1-10-8-11-4-5-12-17(16(11)15(9-10)31-3)21(27)19-14(32-33(28,29)22(23,24)25)7-6-13(30-2)18(19)20(12)26/h6-9H,4-5H2,1-3H3 |
| InChIKey | RREKVTWUHFTXPG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|