C24H14F6O3 — CID 118987389
2-[3-[[2,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]chromen-4-one (PubChem CID 118987389) has the molecular formula C24H14F6O3 and a molecular weight of 464.36 g/mol. Its IUPAC name is 2-[3-[[2,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]chromen-4-one.
| Compound Name | 2-[3-[[2,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]chromen-4-one |
|---|---|
| PubChem CID | 118987389 |
| Molecular Formula | C24H14F6O3 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 2-[3-[[2,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]chromen-4-one |
| SMILES | O=c1cc(-c2cccc(OCc3cc(C(F)(F)F)ccc3C(F)(F)F)c2)oc2ccccc12 |
| InChI | InChI=1S/C24H14F6O3/c25-23(26,27)16-8-9-19(24(28,29)30)15(10-16)13-32-17-5-3-4-14(11-17)22-12-20(31)18-6-1-2-7-21(18)33-22/h1-12H,13H2 |
| InChIKey | KYIGTIYYTIGLJV-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |