C19H12F6O2S — CID 146557451
5-[3-[[2,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]thiophen-2-ol (PubChem CID 146557451) has the molecular formula C19H12F6O2S and a molecular weight of 418.36 g/mol. Its IUPAC name is 5-[3-[[2,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]thiophen-2-ol.
| Compound Name | 5-[3-[[2,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]thiophen-2-ol |
|---|---|
| PubChem CID | 146557451 |
| Molecular Formula | C19H12F6O2S |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 5-[3-[[2,5-bis(trifluoromethyl)phenyl]methoxy]phenyl]thiophen-2-ol |
| SMILES | Oc1ccc(-c2cccc(OCc3cc(C(F)(F)F)ccc3C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C19H12F6O2S/c20-18(21,22)13-4-5-15(19(23,24)25)12(8-13)10-27-14-3-1-2-11(9-14)16-6-7-17(26)28-16/h1-9,26H,10H2 |
| InChIKey | YXERXTBYKUCOFG-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |