C23H13F7N2O — CID 11853301
4-[3-[[5-fluoro-2-(trifluoromethyl)phenyl]methoxy]phenyl]-8-(trifluoromethyl)cinnoline (PubChem CID 11853301) has the molecular formula C23H13F7N2O and a molecular weight of 466.36 g/mol. Its IUPAC name is 4-[3-[[5-fluoro-2-(trifluoromethyl)phenyl]methoxy]phenyl]-8-(trifluoromethyl)cinnoline.
| Compound Name | 4-[3-[[5-fluoro-2-(trifluoromethyl)phenyl]methoxy]phenyl]-8-(trifluoromethyl)cinnoline |
|---|---|
| PubChem CID | 11853301 |
| Molecular Formula | C23H13F7N2O |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 4-[3-[[5-fluoro-2-(trifluoromethyl)phenyl]methoxy]phenyl]-8-(trifluoromethyl)cinnoline |
| SMILES | Fc1ccc(C(F)(F)F)c(COc2cccc(-c3cnnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C23H13F7N2O/c24-15-7-8-19(22(25,26)27)14(9-15)12-33-16-4-1-3-13(10-16)18-11-31-32-21-17(18)5-2-6-20(21)23(28,29)30/h1-11H,12H2 |
| InChIKey | JXHNOPOHPJYVFP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |