C26H20F3NO3 — CID 66914187
3-[3-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]propanoic acid (PubChem CID 66914187) has the molecular formula C26H20F3NO3 and a molecular weight of 451.44 g/mol. Its IUPAC name is 3-[3-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 66914187 |
| Molecular Formula | C26H20F3NO3 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 3-[3-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1cccc(COc2cccc(-c3ccnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C26H20F3NO3/c27-26(28,29)23-9-3-8-22-21(12-13-30-25(22)23)19-6-2-7-20(15-19)33-16-18-5-1-4-17(14-18)10-11-24(31)32/h1-9,12-15H,10-11,16H2,(H,31,32) |
| InChIKey | ZFBJJVAGKDPAJD-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |