C25H18F3NO3 — CID 66913937
2-[4-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]acetic acid (PubChem CID 66913937) has the molecular formula C25H18F3NO3 and a molecular weight of 437.42 g/mol. Its IUPAC name is 2-[4-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 66913937 |
| Molecular Formula | C25H18F3NO3 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 2-[4-[[3-[8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(COc2cccc(-c3ccnc4c(C(F)(F)F)cccc34)c2)cc1 |
| InChI | InChI=1S/C25H18F3NO3/c26-25(27,28)22-6-2-5-21-20(11-12-29-24(21)22)18-3-1-4-19(14-18)32-15-17-9-7-16(8-10-17)13-23(30)31/h1-12,14H,13,15H2,(H,30,31) |
| InChIKey | KLDOSEHGJHFYIQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |