C30H21ClF3NO — CID 141119965
4-[3-[[4-(chloromethyl)phenyl]methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline (PubChem CID 141119965) has the molecular formula C30H21ClF3NO and a molecular weight of 503.95 g/mol. Its IUPAC name is 4-[3-[[4-(chloromethyl)phenyl]methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline.
| Compound Name | 4-[3-[[4-(chloromethyl)phenyl]methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 141119965 |
| Molecular Formula | C30H21ClF3NO |
| Molecular Weight | 503.95 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | 4-[3-[[4-(chloromethyl)phenyl]methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline |
| SMILES | FC(F)(F)c1cccc2c(-c3cccc(OCc4ccc(CCl)cc4)c3)c(-c3ccccc3)cnc12 |
| InChI | InChI=1S/C30H21ClF3NO/c31-17-20-12-14-21(15-13-20)19-36-24-9-4-8-23(16-24)28-25-10-5-11-27(30(32,33)34)29(25)35-18-26(28)22-6-2-1-3-7-22/h1-16,18H,17,19H2 |
| InChIKey | LQAIXPHVHIDHKQ-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.95 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|