C32H24F3NO3 — CID 66914712
[2-methyl-4-[[3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] acetate (PubChem CID 66914712) has the molecular formula C32H24F3NO3 and a molecular weight of 527.54 g/mol. Its IUPAC name is [2-methyl-4-[[3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] acetate.
| Compound Name | [2-methyl-4-[[3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 66914712 |
| Molecular Formula | C32H24F3NO3 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | [2-methyl-4-[[3-[3-phenyl-8-(trifluoromethyl)quinolin-4-yl]phenoxy]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(COc2cccc(-c3c(-c4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)cc1C |
| InChI | InChI=1S/C32H24F3NO3/c1-20-16-22(14-15-29(20)39-21(2)37)19-38-25-11-6-10-24(17-25)30-26-12-7-13-28(32(33,34)35)31(26)36-18-27(30)23-8-4-3-5-9-23/h3-18H,19H2,1-2H3 |
| InChIKey | PSBGXZBNAIYOJO-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|