C30H22F3NO2 — CID 66914261
4-[3-[(2-methoxyphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline (PubChem CID 66914261) has the molecular formula C30H22F3NO2 and a molecular weight of 485.51 g/mol. Its IUPAC name is 4-[3-[(2-methoxyphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline.
| Compound Name | 4-[3-[(2-methoxyphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 66914261 |
| Molecular Formula | C30H22F3NO2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 4-[3-[(2-methoxyphenyl)methoxy]phenyl]-3-phenyl-8-(trifluoromethyl)quinoline |
| SMILES | COc1ccccc1COc1cccc(-c2c(-c3ccccc3)cnc3c(C(F)(F)F)cccc23)c1 |
| InChI | InChI=1S/C30H22F3NO2/c1-35-27-16-6-5-11-22(27)19-36-23-13-7-12-21(17-23)28-24-14-8-15-26(30(31,32)33)29(24)34-18-25(28)20-9-3-2-4-10-20/h2-18H,19H2,1H3 |
| InChIKey | WQAUEENITSGLJS-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |