C24H18F3NO2 — CID 66914038
3-[(4-methoxyphenoxy)methyl]-4-phenyl-8-(trifluoromethyl)quinoline (PubChem CID 66914038) has the molecular formula C24H18F3NO2 and a molecular weight of 409.41 g/mol. Its IUPAC name is 3-[(4-methoxyphenoxy)methyl]-4-phenyl-8-(trifluoromethyl)quinoline.
| Compound Name | 3-[(4-methoxyphenoxy)methyl]-4-phenyl-8-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 66914038 |
| Molecular Formula | C24H18F3NO2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 3-[(4-methoxyphenoxy)methyl]-4-phenyl-8-(trifluoromethyl)quinoline |
| SMILES | COc1ccc(OCc2cnc3c(C(F)(F)F)cccc3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18F3NO2/c1-29-18-10-12-19(13-11-18)30-15-17-14-28-23-20(8-5-9-21(23)24(25,26)27)22(17)16-6-3-2-4-7-16/h2-14H,15H2,1H3 |
| InChIKey | DSBJZLHQIVURBZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |