C31H24F4N2O — CID 66914569
3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(2-fluoro-5-methoxyphenyl)methyl]aniline (PubChem CID 66914569) has the molecular formula C31H24F4N2O and a molecular weight of 516.54 g/mol. Its IUPAC name is 3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(2-fluoro-5-methoxyphenyl)methyl]aniline.
| Compound Name | 3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(2-fluoro-5-methoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 66914569 |
| Molecular Formula | C31H24F4N2O |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 3-[3-benzyl-8-(trifluoromethyl)quinolin-4-yl]-N-[(2-fluoro-5-methoxyphenyl)methyl]aniline |
| SMILES | COc1ccc(F)c(CNc2cccc(-c3c(Cc4ccccc4)cnc4c(C(F)(F)F)cccc34)c2)c1 |
| InChI | InChI=1S/C31H24F4N2O/c1-38-25-13-14-28(32)22(17-25)18-36-24-10-5-9-21(16-24)29-23(15-20-7-3-2-4-8-20)19-37-30-26(29)11-6-12-27(30)31(33,34)35/h2-14,16-17,19,36H,15,18H2,1H3 |
| InChIKey | IODIHESVJYLOLR-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |