C25H19F3N2O — CID 87585136
4-[3-(2-phenylethylamino)phenyl]-8-(trifluoromethyl)quinoline-3-carbaldehyde (PubChem CID 87585136) has the molecular formula C25H19F3N2O and a molecular weight of 420.43 g/mol. Its IUPAC name is 4-[3-(2-phenylethylamino)phenyl]-8-(trifluoromethyl)quinoline-3-carbaldehyde.
| Compound Name | 4-[3-(2-phenylethylamino)phenyl]-8-(trifluoromethyl)quinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 87585136 |
| Molecular Formula | C25H19F3N2O |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 4-[3-(2-phenylethylamino)phenyl]-8-(trifluoromethyl)quinoline-3-carbaldehyde |
| SMILES | O=Cc1cnc2c(C(F)(F)F)cccc2c1-c1cccc(NCCc2ccccc2)c1 |
| InChI | InChI=1S/C25H19F3N2O/c26-25(27,28)22-11-5-10-21-23(19(16-31)15-30-24(21)22)18-8-4-9-20(14-18)29-13-12-17-6-2-1-3-7-17/h1-11,14-16,29H,12-13H2 |
| InChIKey | GTHBZVDNAVSSOK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|